C24H30N6O3 — CID 57441922
5-[2,4-bis[(3S)-3-methylmorpholin-4-yl]pyrido[2,3-d]pyrimidin-7-yl]-2-methoxyaniline (PubChem CID 57441922) has the molecular formula C24H30N6O3 and a molecular weight of 450.54 g/mol. Its IUPAC name is 5-[2,4-bis[(3S)-3-methylmorpholin-4-yl]pyrido[2,3-d]pyrimidin-7-yl]-2-methoxyaniline.
| Compound Name | 5-[2,4-bis[(3S)-3-methylmorpholin-4-yl]pyrido[2,3-d]pyrimidin-7-yl]-2-methoxyaniline |
|---|---|
| PubChem CID | 57441922 |
| Molecular Formula | C24H30N6O3 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.24 |
| IUPAC Name | 5-[2,4-bis[(3S)-3-methylmorpholin-4-yl]pyrido[2,3-d]pyrimidin-7-yl]-2-methoxyaniline |
| SMILES | COc1ccc(-c2ccc3c(N4CCOC[C@@H]4C)nc(N4CCOC[C@@H]4C)nc3n2)cc1N |
| InChI | InChI=1S/C24H30N6O3/c1-15-13-32-10-8-29(15)23-18-5-6-20(17-4-7-21(31-3)19(25)12-17)26-22(18)27-24(28-23)30-9-11-33-14-16(30)2/h4-7,12,15-16H,8-11,13-14,25H2,1-3H3/t15-,16-/m0/s1 |
| InChIKey | TWDPUOBVKZYWCL-HOTGVXAUSA-N |
| XLogP | 2.73 |
| TPSA | 98.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|