C27H36N6O3 — CID 57441961
N-[[3-[2,4-bis[(3S)-3-methylmorpholin-4-yl]pyrido[2,3-d]pyrimidin-7-yl]phenyl]methyl]-2-methoxyethanamine (PubChem CID 57441961) has the molecular formula C27H36N6O3 and a molecular weight of 492.62 g/mol. Its IUPAC name is N-[[3-[2,4-bis[(3S)-3-methylmorpholin-4-yl]pyrido[2,3-d]pyrimidin-7-yl]phenyl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[3-[2,4-bis[(3S)-3-methylmorpholin-4-yl]pyrido[2,3-d]pyrimidin-7-yl]phenyl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 57441961 |
| Molecular Formula | C27H36N6O3 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.28 |
| IUPAC Name | N-[[3-[2,4-bis[(3S)-3-methylmorpholin-4-yl]pyrido[2,3-d]pyrimidin-7-yl]phenyl]methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1cccc(-c2ccc3c(N4CCOC[C@@H]4C)nc(N4CCOC[C@@H]4C)nc3n2)c1 |
| InChI | InChI=1S/C27H36N6O3/c1-19-17-35-13-10-32(19)26-23-7-8-24(22-6-4-5-21(15-22)16-28-9-12-34-3)29-25(23)30-27(31-26)33-11-14-36-18-20(33)2/h4-8,15,19-20,28H,9-14,16-18H2,1-3H3/t19-,20-/m0/s1 |
| InChIKey | JDNUJPXLDZLWMM-PMACEKPBSA-N |
| XLogP | 2.88 |
| TPSA | 84.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|