C29H40N6O3 — CID 57441973
N-[[5-[2,4-bis[(3S)-3-methylmorpholin-4-yl]pyrido[2,3-d]pyrimidin-7-yl]-2-methoxyphenyl]methyl]butan-1-amine (PubChem CID 57441973) has the molecular formula C29H40N6O3 and a molecular weight of 520.68 g/mol. Its IUPAC name is N-[[5-[2,4-bis[(3S)-3-methylmorpholin-4-yl]pyrido[2,3-d]pyrimidin-7-yl]-2-methoxyphenyl]methyl]butan-1-amine.
| Compound Name | N-[[5-[2,4-bis[(3S)-3-methylmorpholin-4-yl]pyrido[2,3-d]pyrimidin-7-yl]-2-methoxyphenyl]methyl]butan-1-amine |
|---|---|
| PubChem CID | 57441973 |
| Molecular Formula | C29H40N6O3 |
| Molecular Weight | 520.68 g/mol |
| Exact Mass | 520.32 |
| IUPAC Name | N-[[5-[2,4-bis[(3S)-3-methylmorpholin-4-yl]pyrido[2,3-d]pyrimidin-7-yl]-2-methoxyphenyl]methyl]butan-1-amine |
| SMILES | CCCCNCc1cc(-c2ccc3c(N4CCOC[C@@H]4C)nc(N4CCOC[C@@H]4C)nc3n2)ccc1OC |
| InChI | InChI=1S/C29H40N6O3/c1-5-6-11-30-17-23-16-22(7-10-26(23)36-4)25-9-8-24-27(31-25)32-29(35-13-15-38-19-21(35)3)33-28(24)34-12-14-37-18-20(34)2/h7-10,16,20-21,30H,5-6,11-15,17-19H2,1-4H3/t20-,21-/m0/s1 |
| InChIKey | CTIXTOXZXGACFK-SFTDATJTSA-N |
| XLogP | 4.04 |
| TPSA | 84.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.68 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|