C27H36N6O4 — CID 57441974
2-[[5-[2,4-bis[(3S)-3-methylmorpholin-4-yl]pyrido[2,3-d]pyrimidin-7-yl]-2-methoxyphenyl]methylamino]ethanol (PubChem CID 57441974) has the molecular formula C27H36N6O4 and a molecular weight of 508.62 g/mol. Its IUPAC name is 2-[[5-[2,4-bis[(3S)-3-methylmorpholin-4-yl]pyrido[2,3-d]pyrimidin-7-yl]-2-methoxyphenyl]methylamino]ethanol.
| Compound Name | 2-[[5-[2,4-bis[(3S)-3-methylmorpholin-4-yl]pyrido[2,3-d]pyrimidin-7-yl]-2-methoxyphenyl]methylamino]ethanol |
|---|---|
| PubChem CID | 57441974 |
| Molecular Formula | C27H36N6O4 |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.28 |
| IUPAC Name | 2-[[5-[2,4-bis[(3S)-3-methylmorpholin-4-yl]pyrido[2,3-d]pyrimidin-7-yl]-2-methoxyphenyl]methylamino]ethanol |
| SMILES | COc1ccc(-c2ccc3c(N4CCOC[C@@H]4C)nc(N4CCOC[C@@H]4C)nc3n2)cc1CNCCO |
| InChI | InChI=1S/C27H36N6O4/c1-18-16-36-12-9-32(18)26-22-5-6-23(20-4-7-24(35-3)21(14-20)15-28-8-11-34)29-25(22)30-27(31-26)33-10-13-37-17-19(33)2/h4-7,14,18-19,28,34H,8-13,15-17H2,1-3H3/t18-,19-/m0/s1 |
| InChIKey | YPGCYUPZBDGOEX-OALUTQOASA-N |
| XLogP | 2.23 |
| TPSA | 105.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|