C25H30N6O4 — CID 57442010
5-[2,4-bis[(3S)-3-methylmorpholin-4-yl]pyrido[2,3-d]pyrimidin-7-yl]-2-methoxybenzamide (PubChem CID 57442010) has the molecular formula C25H30N6O4 and a molecular weight of 478.55 g/mol. Its IUPAC name is 5-[2,4-bis[(3S)-3-methylmorpholin-4-yl]pyrido[2,3-d]pyrimidin-7-yl]-2-methoxybenzamide.
| Compound Name | 5-[2,4-bis[(3S)-3-methylmorpholin-4-yl]pyrido[2,3-d]pyrimidin-7-yl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 57442010 |
| Molecular Formula | C25H30N6O4 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.23 |
| IUPAC Name | 5-[2,4-bis[(3S)-3-methylmorpholin-4-yl]pyrido[2,3-d]pyrimidin-7-yl]-2-methoxybenzamide |
| SMILES | COc1ccc(-c2ccc3c(N4CCOC[C@@H]4C)nc(N4CCOC[C@@H]4C)nc3n2)cc1C(N)=O |
| InChI | InChI=1S/C25H30N6O4/c1-15-13-34-10-8-30(15)24-18-5-6-20(17-4-7-21(33-3)19(12-17)22(26)32)27-23(18)28-25(29-24)31-9-11-35-14-16(31)2/h4-7,12,15-16H,8-11,13-14H2,1-3H3,(H2,26,32)/t15-,16-/m0/s1 |
| InChIKey | TUDAPCLGABKYQN-HOTGVXAUSA-N |
| XLogP | 2.25 |
| TPSA | 115.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |