C19H30N6O2 — CID 57443047
1-(4-cyclobutylpiperazin-1-yl)-2-[4-(6-methoxypyridazin-3-yl)piperazin-1-yl]ethanone (PubChem CID 57443047) has the molecular formula C19H30N6O2 and a molecular weight of 374.49 g/mol. Its IUPAC name is 1-(4-cyclobutylpiperazin-1-yl)-2-[4-(6-methoxypyridazin-3-yl)piperazin-1-yl]ethanone.
| Compound Name | 1-(4-cyclobutylpiperazin-1-yl)-2-[4-(6-methoxypyridazin-3-yl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 57443047 |
| Molecular Formula | C19H30N6O2 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.24 |
| IUPAC Name | 1-(4-cyclobutylpiperazin-1-yl)-2-[4-(6-methoxypyridazin-3-yl)piperazin-1-yl]ethanone |
| SMILES | COc1ccc(N2CCN(CC(=O)N3CCN(C4CCC4)CC3)CC2)nn1 |
| InChI | InChI=1S/C19H30N6O2/c1-27-18-6-5-17(20-21-18)24-9-7-22(8-10-24)15-19(26)25-13-11-23(12-14-25)16-3-2-4-16/h5-6,16H,2-4,7-15H2,1H3 |
| InChIKey | BTUHVVTYRHJWKS-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 65.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |