About ditert-butyl 2-[4-(1,3-dioxolan-2-yl)-3-fluorophenyl]-2-methylpropanedioate
ditert-butyl 2-[4-(1,3-dioxolan-2-yl)-3-fluorophenyl]-2-methylpropanedioate (PubChem CID 57443965) has the molecular formula C21H29FO6
and a molecular weight of 396.46 g/mol. Its IUPAC name is ditert-butyl 2-[4-(1,3-dioxolan-2-yl)-3-fluorophenyl]-2-methylpropanedioate.
Molecular Properties
| Compound Name | ditert-butyl 2-[4-(1,3-dioxolan-2-yl)-3-fluorophenyl]-2-methylpropanedioate |
| PubChem CID | 57443965 |
| Molecular Formula | C21H29FO6 |
| Molecular Weight | 396.46 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | ditert-butyl 2-[4-(1,3-dioxolan-2-yl)-3-fluorophenyl]-2-methylpropanedioate |
| SMILES | CC(C)(C)OC(=O)C(C)(C(=O)OC(C)(C)C)c1ccc(C2OCCO2)c(F)c1 |
| InChI | InChI=1S/C21H29FO6/c1-19(2,3)27-17(23)21(7,18(24)28-20(4,5)6)13-8-9-14(15(22)12-13)16-25-10-11-26-16/h8-9,12,16H,10-11H2,1-7H3 |
| InChIKey | DZEPYUYBTLGRTH-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.46 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ditert-butyl 2-[4-(1,3-dioxolan-2-yl)-3-fluorophenyl]-2-methylpropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ditert-butyl 2-[4-(1,3-dioxolan-2-yl)-3-fluorophenyl]-2-methylpropanedioate?
The IUPAC name of ditert-butyl 2-[4-(1,3-dioxolan-2-yl)-3-fluorophenyl]-2-methylpropanedioate (CID 57443965) is ditert-butyl 2-[4-(1,3-dioxolan-2-yl)-3-fluorophenyl]-2-methylpropanedioate.
What is the SMILES notation for ditert-butyl 2-[4-(1,3-dioxolan-2-yl)-3-fluorophenyl]-2-methylpropanedioate?
The canonical SMILES for ditert-butyl 2-[4-(1,3-dioxolan-2-yl)-3-fluorophenyl]-2-methylpropanedioate is CC(C)(C)OC(=O)C(C)(C(=O)OC(C)(C)C)c1ccc(C2OCCO2)c(F)c1.
What is the InChIKey of ditert-butyl 2-[4-(1,3-dioxolan-2-yl)-3-fluorophenyl]-2-methylpropanedioate?
The InChIKey is DZEPYUYBTLGRTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H29FO6/c1-19(2,3)27-17(23)21(7,18(24)28-20(4,5)6)13-8-9-14(15(22)12-13)16-25-10-11-26-16/h8-9,12,16H,10-11H2,1-7H3.
What are the key properties of ditert-butyl 2-[4-(1,3-dioxolan-2-yl)-3-fluorophenyl]-2-methylpropanedioate?
ditert-butyl 2-[4-(1,3-dioxolan-2-yl)-3-fluorophenyl]-2-methylpropanedioate has a molecular weight of 396.46 g/mol, XLogP of 3.81, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ditert-butyl 2-[4-(1,3-dioxolan-2-yl)-3-fluorophenyl]-2-methylpropanedioate is sourced from PubChem (CID 57443965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).