About 2-benzylsulfanyl-6,7-dihydro-5H-quinazolin-8-one
2-benzylsulfanyl-6,7-dihydro-5H-quinazolin-8-one (PubChem CID 57444113) has the molecular formula C15H14N2OS
and a molecular weight of 270.36 g/mol. Its IUPAC name is 2-benzylsulfanyl-6,7-dihydro-5H-quinazolin-8-one.
Molecular Properties
| Compound Name | 2-benzylsulfanyl-6,7-dihydro-5H-quinazolin-8-one |
| PubChem CID | 57444113 |
| Molecular Formula | C15H14N2OS |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 2-benzylsulfanyl-6,7-dihydro-5H-quinazolin-8-one |
| SMILES | O=C1CCCc2cnc(SCc3ccccc3)nc21 |
| InChI | InChI=1S/C15H14N2OS/c18-13-8-4-7-12-9-16-15(17-14(12)13)19-10-11-5-2-1-3-6-11/h1-3,5-6,9H,4,7-8,10H2 |
| InChIKey | AZYZXHAWWJMPHT-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-benzylsulfanyl-6,7-dihydro-5H-quinazolin-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzylsulfanyl-6,7-dihydro-5H-quinazolin-8-one?
The IUPAC name of 2-benzylsulfanyl-6,7-dihydro-5H-quinazolin-8-one (CID 57444113) is 2-benzylsulfanyl-6,7-dihydro-5H-quinazolin-8-one.
What is the SMILES notation for 2-benzylsulfanyl-6,7-dihydro-5H-quinazolin-8-one?
The canonical SMILES for 2-benzylsulfanyl-6,7-dihydro-5H-quinazolin-8-one is O=C1CCCc2cnc(SCc3ccccc3)nc21.
What is the InChIKey of 2-benzylsulfanyl-6,7-dihydro-5H-quinazolin-8-one?
The InChIKey is AZYZXHAWWJMPHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N2OS/c18-13-8-4-7-12-9-16-15(17-14(12)13)19-10-11-5-2-1-3-6-11/h1-3,5-6,9H,4,7-8,10H2.
What are the key properties of 2-benzylsulfanyl-6,7-dihydro-5H-quinazolin-8-one?
2-benzylsulfanyl-6,7-dihydro-5H-quinazolin-8-one has a molecular weight of 270.36 g/mol, XLogP of 3.29, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzylsulfanyl-6,7-dihydro-5H-quinazolin-8-one is sourced from PubChem (CID 57444113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).