C24H28FN7O2 — CID 57444124
ethyl 8-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]-1-methyl-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carboxylate (PubChem CID 57444124) has the molecular formula C24H28FN7O2 and a molecular weight of 465.53 g/mol. Its IUPAC name is ethyl 8-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]-1-methyl-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carboxylate.
| Compound Name | ethyl 8-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]-1-methyl-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carboxylate |
|---|---|
| PubChem CID | 57444124 |
| Molecular Formula | C24H28FN7O2 |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | ethyl 8-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]-1-methyl-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carboxylate |
| SMILES | CCOC(=O)c1nn(C)c2c1CCc1cnc(Nc3ccc(N4CCN(C)CC4)c(F)c3)nc1-2 |
| InChI | InChI=1S/C24H28FN7O2/c1-4-34-23(33)21-17-7-5-15-14-26-24(28-20(15)22(17)31(3)29-21)27-16-6-8-19(18(25)13-16)32-11-9-30(2)10-12-32/h6,8,13-14H,4-5,7,9-12H2,1-3H3,(H,26,27,28) |
| InChIKey | QOHUKCNSJNYUPB-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|