About 5-benzyl-4,6-dichloro-2-methylpyrimidine
5-benzyl-4,6-dichloro-2-methylpyrimidine (PubChem CID 57444181) has the molecular formula C12H10Cl2N2
and a molecular weight of 253.13 g/mol. Its IUPAC name is 5-benzyl-4,6-dichloro-2-methylpyrimidine.
Molecular Properties
| Compound Name | 5-benzyl-4,6-dichloro-2-methylpyrimidine |
| PubChem CID | 57444181 |
| Molecular Formula | C12H10Cl2N2 |
| Molecular Weight | 253.13 g/mol |
| Exact Mass | 252.02 |
| IUPAC Name | 5-benzyl-4,6-dichloro-2-methylpyrimidine |
| SMILES | Cc1nc(Cl)c(Cc2ccccc2)c(Cl)n1 |
| InChI | InChI=1S/C12H10Cl2N2/c1-8-15-11(13)10(12(14)16-8)7-9-5-3-2-4-6-9/h2-6H,7H2,1H3 |
| InChIKey | SKDRYEODPURSOX-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.13 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-benzyl-4,6-dichloro-2-methylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-benzyl-4,6-dichloro-2-methylpyrimidine?
The IUPAC name of 5-benzyl-4,6-dichloro-2-methylpyrimidine (CID 57444181) is 5-benzyl-4,6-dichloro-2-methylpyrimidine.
What is the SMILES notation for 5-benzyl-4,6-dichloro-2-methylpyrimidine?
The canonical SMILES for 5-benzyl-4,6-dichloro-2-methylpyrimidine is Cc1nc(Cl)c(Cc2ccccc2)c(Cl)n1.
What is the InChIKey of 5-benzyl-4,6-dichloro-2-methylpyrimidine?
The InChIKey is SKDRYEODPURSOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10Cl2N2/c1-8-15-11(13)10(12(14)16-8)7-9-5-3-2-4-6-9/h2-6H,7H2,1H3.
What are the key properties of 5-benzyl-4,6-dichloro-2-methylpyrimidine?
5-benzyl-4,6-dichloro-2-methylpyrimidine has a molecular weight of 253.13 g/mol, XLogP of 3.68, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-benzyl-4,6-dichloro-2-methylpyrimidine is sourced from PubChem (CID 57444181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).