C11H11NO3 — CID 57444342
2-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]acetaldehyde (PubChem CID 57444342) has the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. Its IUPAC name is 2-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]acetaldehyde.
| Compound Name | 2-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]acetaldehyde |
|---|---|
| PubChem CID | 57444342 |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 2-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]acetaldehyde |
| SMILES | O=CCc1cccc(N2CCOC2=O)c1 |
| InChI | InChI=1S/C11H11NO3/c13-6-4-9-2-1-3-10(8-9)12-5-7-15-11(12)14/h1-3,6,8H,4-5,7H2 |
| InChIKey | ZHQJMRCIGGADLN-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|