C25H29F3N6 — CID 57444436
[6-[cyclopentylmethyl(ethyl)amino]-1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl]methyl-[(3,4,5-trifluorophenyl)methyl]cyanamide (PubChem CID 57444436) has the molecular formula C25H29F3N6 and a molecular weight of 470.54 g/mol. Its IUPAC name is [6-[cyclopentylmethyl(ethyl)amino]-1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl]methyl-[(3,4,5-trifluorophenyl)methyl]cyanamide.
| Compound Name | [6-[cyclopentylmethyl(ethyl)amino]-1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl]methyl-[(3,4,5-trifluorophenyl)methyl]cyanamide |
|---|---|
| PubChem CID | 57444436 |
| Molecular Formula | C25H29F3N6 |
| Molecular Weight | 470.54 g/mol |
| Exact Mass | 470.24 |
| IUPAC Name | [6-[cyclopentylmethyl(ethyl)amino]-1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl]methyl-[(3,4,5-trifluorophenyl)methyl]cyanamide |
| SMILES | CCN(CC1CCCC1)c1nc2c(cc1CN(C#N)Cc1cc(F)c(F)c(F)c1)c(C)nn2C |
| InChI | InChI=1S/C25H29F3N6/c1-4-34(13-17-7-5-6-8-17)24-19(11-20-16(2)31-32(3)25(20)30-24)14-33(15-29)12-18-9-21(26)23(28)22(27)10-18/h9-11,17H,4-8,12-14H2,1-3H3 |
| InChIKey | YGVXCBUYAFBFSW-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 60.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.54 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|