About 1-(1-azido-2,2,2-trifluoroethyl)-2-bromo-4-fluorobenzene
1-(1-azido-2,2,2-trifluoroethyl)-2-bromo-4-fluorobenzene (PubChem CID 57445068) has the molecular formula C8H4BrF4N3
and a molecular weight of 298.04 g/mol. Its IUPAC name is 1-(1-azido-2,2,2-trifluoroethyl)-2-bromo-4-fluorobenzene.
Molecular Properties
| Compound Name | 1-(1-azido-2,2,2-trifluoroethyl)-2-bromo-4-fluorobenzene |
| PubChem CID | 57445068 |
| Molecular Formula | C8H4BrF4N3 |
| Molecular Weight | 298.04 g/mol |
| Exact Mass | 296.95 |
| IUPAC Name | 1-(1-azido-2,2,2-trifluoroethyl)-2-bromo-4-fluorobenzene |
| SMILES | [N-]=[N+]=NC(c1ccc(F)cc1Br)C(F)(F)F |
| InChI | InChI=1S/C8H4BrF4N3/c9-6-3-4(10)1-2-5(6)7(15-16-14)8(11,12)13/h1-3,7H |
| InChIKey | DZOMROPNNIVDLB-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.04 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-azido-2,2,2-trifluoroethyl)-2-bromo-4-fluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-azido-2,2,2-trifluoroethyl)-2-bromo-4-fluorobenzene?
The IUPAC name of 1-(1-azido-2,2,2-trifluoroethyl)-2-bromo-4-fluorobenzene (CID 57445068) is 1-(1-azido-2,2,2-trifluoroethyl)-2-bromo-4-fluorobenzene.
What is the SMILES notation for 1-(1-azido-2,2,2-trifluoroethyl)-2-bromo-4-fluorobenzene?
The canonical SMILES for 1-(1-azido-2,2,2-trifluoroethyl)-2-bromo-4-fluorobenzene is [N-]=[N+]=NC(c1ccc(F)cc1Br)C(F)(F)F.
What is the InChIKey of 1-(1-azido-2,2,2-trifluoroethyl)-2-bromo-4-fluorobenzene?
The InChIKey is DZOMROPNNIVDLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4BrF4N3/c9-6-3-4(10)1-2-5(6)7(15-16-14)8(11,12)13/h1-3,7H.
What are the key properties of 1-(1-azido-2,2,2-trifluoroethyl)-2-bromo-4-fluorobenzene?
1-(1-azido-2,2,2-trifluoroethyl)-2-bromo-4-fluorobenzene has a molecular weight of 298.04 g/mol, XLogP of 4.50, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-azido-2,2,2-trifluoroethyl)-2-bromo-4-fluorobenzene is sourced from PubChem (CID 57445068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).