C19H22ClN3O4S — CID 57445197
8-chloro-7-(2,2-dimethoxyethoxy)-2-[2-(propan-2-ylamino)-1,3-thiazol-4-yl]-1H-quinolin-4-one (PubChem CID 57445197) has the molecular formula C19H22ClN3O4S and a molecular weight of 423.92 g/mol. Its IUPAC name is 8-chloro-7-(2,2-dimethoxyethoxy)-2-[2-(propan-2-ylamino)-1,3-thiazol-4-yl]-1H-quinolin-4-one.
| Compound Name | 8-chloro-7-(2,2-dimethoxyethoxy)-2-[2-(propan-2-ylamino)-1,3-thiazol-4-yl]-1H-quinolin-4-one |
|---|---|
| PubChem CID | 57445197 |
| Molecular Formula | C19H22ClN3O4S |
| Molecular Weight | 423.92 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | 8-chloro-7-(2,2-dimethoxyethoxy)-2-[2-(propan-2-ylamino)-1,3-thiazol-4-yl]-1H-quinolin-4-one |
| SMILES | COC(COc1ccc2c(=O)cc(-c3csc(NC(C)C)n3)[nH]c2c1Cl)OC |
| InChI | InChI=1S/C19H22ClN3O4S/c1-10(2)21-19-23-13(9-28-19)12-7-14(24)11-5-6-15(17(20)18(11)22-12)27-8-16(25-3)26-4/h5-7,9-10,16H,8H2,1-4H3,(H,21,23)(H,22,24) |
| InChIKey | JVWNQRBIIRUQJX-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 85.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.92 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|