thieno[2,3-d]pyrimidine-6-carboxylic acid

C7H4N2O2S — CID 57445646

IUPACthieno[2,3-d]pyrimidine-6-carboxylic acid
SMILESO=C(O)c1cc2cncnc2s1
InChIInChI=1S/C7H4N2O2S/c10-7(11)5-1-4-2-8-3-9-6(4)12-5/h1-3H,(H,10,11)
InChIKeyHACJQZHGTLOKSH-UHFFFAOYSA-N
MW180.19 g/mol
LogP1.39
Rot. Bonds1

About thieno[2,3-d]pyrimidine-6-carboxylic acid

thieno[2,3-d]pyrimidine-6-carboxylic acid (PubChem CID 57445646) has the molecular formula C7H4N2O2S and a molecular weight of 180.19 g/mol. Its IUPAC name is thieno[2,3-d]pyrimidine-6-carboxylic acid.

Molecular Properties

Compound Namethieno[2,3-d]pyrimidine-6-carboxylic acid
PubChem CID57445646
Molecular FormulaC7H4N2O2S
Molecular Weight180.19 g/mol
Exact Mass180.00
IUPAC Namethieno[2,3-d]pyrimidine-6-carboxylic acid
SMILESO=C(O)c1cc2cncnc2s1
InChIInChI=1S/C7H4N2O2S/c10-7(11)5-1-4-2-8-3-9-6(4)12-5/h1-3H,(H,10,11)
InChIKeyHACJQZHGTLOKSH-UHFFFAOYSA-N
XLogP1.39
TPSA63.08 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500180.19
LogP ≤ 51.39
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze thieno[2,3-d]pyrimidine-6-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of thieno[2,3-d]pyrimidine-6-carboxylic acid?
The IUPAC name of thieno[2,3-d]pyrimidine-6-carboxylic acid (CID 57445646) is thieno[2,3-d]pyrimidine-6-carboxylic acid.
What is the SMILES notation for thieno[2,3-d]pyrimidine-6-carboxylic acid?
The canonical SMILES for thieno[2,3-d]pyrimidine-6-carboxylic acid is O=C(O)c1cc2cncnc2s1.
What is the InChIKey of thieno[2,3-d]pyrimidine-6-carboxylic acid?
The InChIKey is HACJQZHGTLOKSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4N2O2S/c10-7(11)5-1-4-2-8-3-9-6(4)12-5/h1-3H,(H,10,11).
What are the key properties of thieno[2,3-d]pyrimidine-6-carboxylic acid?
thieno[2,3-d]pyrimidine-6-carboxylic acid has a molecular weight of 180.19 g/mol, XLogP of 1.39, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for thieno[2,3-d]pyrimidine-6-carboxylic acid is sourced from PubChem (CID 57445646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).