C20H28N2O3 — CID 57445839
(4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl)-[(3R)-morpholin-3-yl]methanone (PubChem CID 57445839) has the molecular formula C20H28N2O3 and a molecular weight of 344.46 g/mol. Its IUPAC name is (4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl)-[(3R)-morpholin-3-yl]methanone.
| Compound Name | (4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl)-[(3R)-morpholin-3-yl]methanone |
|---|---|
| PubChem CID | 57445839 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | (4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl)-[(3R)-morpholin-3-yl]methanone |
| SMILES | O=C([C@H]1COCCN1)N1CCC(O)(c2ccccc2)C2CCCCC21 |
| InChI | InChI=1S/C20H28N2O3/c23-19(17-14-25-13-11-21-17)22-12-10-20(24,15-6-2-1-3-7-15)16-8-4-5-9-18(16)22/h1-3,6-7,16-18,21,24H,4-5,8-14H2/t16?,17-,18?,20?/m1/s1 |
| InChIKey | AOWSPITYNSPQMY-PLKGECRYSA-N |
| XLogP | 1.65 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |