C12H18BNO2 — CID 57446162
4,4,5,5-tetramethyl-N-phenyl-1,3,2-dioxaborolan-2-amine (PubChem CID 57446162) has the molecular formula C12H18BNO2 and a molecular weight of 219.09 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-N-phenyl-1,3,2-dioxaborolan-2-amine.
| Compound Name | 4,4,5,5-tetramethyl-N-phenyl-1,3,2-dioxaborolan-2-amine |
|---|---|
| PubChem CID | 57446162 |
| Molecular Formula | C12H18BNO2 |
| Molecular Weight | 219.09 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | 4,4,5,5-tetramethyl-N-phenyl-1,3,2-dioxaborolan-2-amine |
| SMILES | CC1(C)OB(Nc2ccccc2)OC1(C)C |
| InChI | InChI=1S/C12H18BNO2/c1-11(2)12(3,4)16-13(15-11)14-10-8-6-5-7-9-10/h5-9,14H,1-4H3 |
| InChIKey | DLAJQEFZFUKNBV-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.09 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|