About 2-[5-(5-chlorothiophen-2-yl)-2-benzofuran-1-yl]-4,5-dihydro-1H-imidazole
2-[5-(5-chlorothiophen-2-yl)-2-benzofuran-1-yl]-4,5-dihydro-1H-imidazole (PubChem CID 57447507) has the molecular formula C15H11ClN2OS
and a molecular weight of 302.79 g/mol. Its IUPAC name is 2-[5-(5-chlorothiophen-2-yl)-2-benzofuran-1-yl]-4,5-dihydro-1H-imidazole.
Molecular Properties
| Compound Name | 2-[5-(5-chlorothiophen-2-yl)-2-benzofuran-1-yl]-4,5-dihydro-1H-imidazole |
| PubChem CID | 57447507 |
| Molecular Formula | C15H11ClN2OS |
| Molecular Weight | 302.79 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | 2-[5-(5-chlorothiophen-2-yl)-2-benzofuran-1-yl]-4,5-dihydro-1H-imidazole |
| SMILES | Clc1ccc(-c2ccc3c(C4=NCCN4)occ3c2)s1 |
| InChI | InChI=1S/C15H11ClN2OS/c16-13-4-3-12(20-13)9-1-2-11-10(7-9)8-19-14(11)15-17-5-6-18-15/h1-4,7-8H,5-6H2,(H,17,18) |
| InChIKey | OLPKIGYUMNHSAT-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.79 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[5-(5-chlorothiophen-2-yl)-2-benzofuran-1-yl]-4,5-dihydro-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(5-chlorothiophen-2-yl)-2-benzofuran-1-yl]-4,5-dihydro-1H-imidazole?
The IUPAC name of 2-[5-(5-chlorothiophen-2-yl)-2-benzofuran-1-yl]-4,5-dihydro-1H-imidazole (CID 57447507) is 2-[5-(5-chlorothiophen-2-yl)-2-benzofuran-1-yl]-4,5-dihydro-1H-imidazole.
What is the SMILES notation for 2-[5-(5-chlorothiophen-2-yl)-2-benzofuran-1-yl]-4,5-dihydro-1H-imidazole?
The canonical SMILES for 2-[5-(5-chlorothiophen-2-yl)-2-benzofuran-1-yl]-4,5-dihydro-1H-imidazole is Clc1ccc(-c2ccc3c(C4=NCCN4)occ3c2)s1.
What is the InChIKey of 2-[5-(5-chlorothiophen-2-yl)-2-benzofuran-1-yl]-4,5-dihydro-1H-imidazole?
The InChIKey is OLPKIGYUMNHSAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11ClN2OS/c16-13-4-3-12(20-13)9-1-2-11-10(7-9)8-19-14(11)15-17-5-6-18-15/h1-4,7-8H,5-6H2,(H,17,18).
What are the key properties of 2-[5-(5-chlorothiophen-2-yl)-2-benzofuran-1-yl]-4,5-dihydro-1H-imidazole?
2-[5-(5-chlorothiophen-2-yl)-2-benzofuran-1-yl]-4,5-dihydro-1H-imidazole has a molecular weight of 302.79 g/mol, XLogP of 4.16, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(5-chlorothiophen-2-yl)-2-benzofuran-1-yl]-4,5-dihydro-1H-imidazole is sourced from PubChem (CID 57447507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).