About 2-[7-[3-(trifluoromethyl)phenyl]-2-benzofuran-1-yl]-4,5-dihydro-1H-imidazole
2-[7-[3-(trifluoromethyl)phenyl]-2-benzofuran-1-yl]-4,5-dihydro-1H-imidazole (PubChem CID 57447547) has the molecular formula C18H13F3N2O
and a molecular weight of 330.31 g/mol. Its IUPAC name is 2-[7-[3-(trifluoromethyl)phenyl]-2-benzofuran-1-yl]-4,5-dihydro-1H-imidazole.
Molecular Properties
| Compound Name | 2-[7-[3-(trifluoromethyl)phenyl]-2-benzofuran-1-yl]-4,5-dihydro-1H-imidazole |
| PubChem CID | 57447547 |
| Molecular Formula | C18H13F3N2O |
| Molecular Weight | 330.31 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 2-[7-[3-(trifluoromethyl)phenyl]-2-benzofuran-1-yl]-4,5-dihydro-1H-imidazole |
| SMILES | FC(F)(F)c1cccc(-c2cccc3coc(C4=NCCN4)c23)c1 |
| InChI | InChI=1S/C18H13F3N2O/c19-18(20,21)13-5-1-3-11(9-13)14-6-2-4-12-10-24-16(15(12)14)17-22-7-8-23-17/h1-6,9-10H,7-8H2,(H,22,23) |
| InChIKey | IAOKSORTAAUUED-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.31 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[7-[3-(trifluoromethyl)phenyl]-2-benzofuran-1-yl]-4,5-dihydro-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[7-[3-(trifluoromethyl)phenyl]-2-benzofuran-1-yl]-4,5-dihydro-1H-imidazole?
The IUPAC name of 2-[7-[3-(trifluoromethyl)phenyl]-2-benzofuran-1-yl]-4,5-dihydro-1H-imidazole (CID 57447547) is 2-[7-[3-(trifluoromethyl)phenyl]-2-benzofuran-1-yl]-4,5-dihydro-1H-imidazole.
What is the SMILES notation for 2-[7-[3-(trifluoromethyl)phenyl]-2-benzofuran-1-yl]-4,5-dihydro-1H-imidazole?
The canonical SMILES for 2-[7-[3-(trifluoromethyl)phenyl]-2-benzofuran-1-yl]-4,5-dihydro-1H-imidazole is FC(F)(F)c1cccc(-c2cccc3coc(C4=NCCN4)c23)c1.
What is the InChIKey of 2-[7-[3-(trifluoromethyl)phenyl]-2-benzofuran-1-yl]-4,5-dihydro-1H-imidazole?
The InChIKey is IAOKSORTAAUUED-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13F3N2O/c19-18(20,21)13-5-1-3-11(9-13)14-6-2-4-12-10-24-16(15(12)14)17-22-7-8-23-17/h1-6,9-10H,7-8H2,(H,22,23).
What are the key properties of 2-[7-[3-(trifluoromethyl)phenyl]-2-benzofuran-1-yl]-4,5-dihydro-1H-imidazole?
2-[7-[3-(trifluoromethyl)phenyl]-2-benzofuran-1-yl]-4,5-dihydro-1H-imidazole has a molecular weight of 330.31 g/mol, XLogP of 4.47, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[7-[3-(trifluoromethyl)phenyl]-2-benzofuran-1-yl]-4,5-dihydro-1H-imidazole is sourced from PubChem (CID 57447547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).