About 5-(4-bromophenyl)-3-(4,5-dihydro-1H-imidazol-2-yl)-2-methyl-1H-indole;hydrochloride
5-(4-bromophenyl)-3-(4,5-dihydro-1H-imidazol-2-yl)-2-methyl-1H-indole;hydrochloride (PubChem CID 57447569) has the molecular formula C18H17BrClN3
and a molecular weight of 390.71 g/mol. Its IUPAC name is 5-(4-bromophenyl)-3-(4,5-dihydro-1H-imidazol-2-yl)-2-methyl-1H-indole;hydrochloride.
Molecular Properties
| Compound Name | 5-(4-bromophenyl)-3-(4,5-dihydro-1H-imidazol-2-yl)-2-methyl-1H-indole;hydrochloride |
| PubChem CID | 57447569 |
| Molecular Formula | C18H17BrClN3 |
| Molecular Weight | 390.71 g/mol |
| Exact Mass | 389.03 |
| IUPAC Name | 5-(4-bromophenyl)-3-(4,5-dihydro-1H-imidazol-2-yl)-2-methyl-1H-indole;hydrochloride |
| SMILES | Cc1[nH]c2ccc(-c3ccc(Br)cc3)cc2c1C1=NCCN1.Cl |
| InChI | InChI=1S/C18H16BrN3.ClH/c1-11-17(18-20-8-9-21-18)15-10-13(4-7-16(15)22-11)12-2-5-14(19)6-3-12;/h2-7,10,22H,8-9H2,1H3,(H,20,21);1H |
| InChIKey | CWSKHSCFXYCFBN-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 40.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.71 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(4-bromophenyl)-3-(4,5-dihydro-1H-imidazol-2-yl)-2-methyl-1H-indole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-bromophenyl)-3-(4,5-dihydro-1H-imidazol-2-yl)-2-methyl-1H-indole;hydrochloride?
The IUPAC name of 5-(4-bromophenyl)-3-(4,5-dihydro-1H-imidazol-2-yl)-2-methyl-1H-indole;hydrochloride (CID 57447569) is 5-(4-bromophenyl)-3-(4,5-dihydro-1H-imidazol-2-yl)-2-methyl-1H-indole;hydrochloride.
What is the SMILES notation for 5-(4-bromophenyl)-3-(4,5-dihydro-1H-imidazol-2-yl)-2-methyl-1H-indole;hydrochloride?
The canonical SMILES for 5-(4-bromophenyl)-3-(4,5-dihydro-1H-imidazol-2-yl)-2-methyl-1H-indole;hydrochloride is Cc1[nH]c2ccc(-c3ccc(Br)cc3)cc2c1C1=NCCN1.Cl.
What is the InChIKey of 5-(4-bromophenyl)-3-(4,5-dihydro-1H-imidazol-2-yl)-2-methyl-1H-indole;hydrochloride?
The InChIKey is CWSKHSCFXYCFBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16BrN3.ClH/c1-11-17(18-20-8-9-21-18)15-10-13(4-7-16(15)22-11)12-2-5-14(19)6-3-12;/h2-7,10,22H,8-9H2,1H3,(H,20,21);1H.
What are the key properties of 5-(4-bromophenyl)-3-(4,5-dihydro-1H-imidazol-2-yl)-2-methyl-1H-indole;hydrochloride?
5-(4-bromophenyl)-3-(4,5-dihydro-1H-imidazol-2-yl)-2-methyl-1H-indole;hydrochloride has a molecular weight of 390.71 g/mol, XLogP of 4.68, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-bromophenyl)-3-(4,5-dihydro-1H-imidazol-2-yl)-2-methyl-1H-indole;hydrochloride is sourced from PubChem (CID 57447569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).