C26H34F2N2O — CID 57447870
7-[4-(4,4-difluoropiperidin-1-yl)butyl]-4-(4-methoxyphenyl)-2-methyl-3,4-dihydro-1H-isoquinoline (PubChem CID 57447870) has the molecular formula C26H34F2N2O and a molecular weight of 428.57 g/mol. Its IUPAC name is 7-[4-(4,4-difluoropiperidin-1-yl)butyl]-4-(4-methoxyphenyl)-2-methyl-3,4-dihydro-1H-isoquinoline.
| Compound Name | 7-[4-(4,4-difluoropiperidin-1-yl)butyl]-4-(4-methoxyphenyl)-2-methyl-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 57447870 |
| Molecular Formula | C26H34F2N2O |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.26 |
| IUPAC Name | 7-[4-(4,4-difluoropiperidin-1-yl)butyl]-4-(4-methoxyphenyl)-2-methyl-3,4-dihydro-1H-isoquinoline |
| SMILES | COc1ccc(C2CN(C)Cc3cc(CCCCN4CCC(F)(F)CC4)ccc32)cc1 |
| InChI | InChI=1S/C26H34F2N2O/c1-29-18-22-17-20(5-3-4-14-30-15-12-26(27,28)13-16-30)6-11-24(22)25(19-29)21-7-9-23(31-2)10-8-21/h6-11,17,25H,3-5,12-16,18-19H2,1-2H3 |
| InChIKey | JIMDWVVSIDWGJV-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|