C15H19F4NO3S — CID 57447967
[2-fluoro-3-(1-propylpiperidin-4-yl)phenyl] trifluoromethanesulfonate (PubChem CID 57447967) has the molecular formula C15H19F4NO3S and a molecular weight of 369.38 g/mol. Its IUPAC name is [2-fluoro-3-(1-propylpiperidin-4-yl)phenyl] trifluoromethanesulfonate.
| Compound Name | [2-fluoro-3-(1-propylpiperidin-4-yl)phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 57447967 |
| Molecular Formula | C15H19F4NO3S |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | [2-fluoro-3-(1-propylpiperidin-4-yl)phenyl] trifluoromethanesulfonate |
| SMILES | CCCN1CCC(c2cccc(OS(=O)(=O)C(F)(F)F)c2F)CC1 |
| InChI | InChI=1S/C15H19F4NO3S/c1-2-8-20-9-6-11(7-10-20)12-4-3-5-13(14(12)16)23-24(21,22)15(17,18)19/h3-5,11H,2,6-10H2,1H3 |
| InChIKey | JPBUIJVCPVXSHM-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|