C18H19N3OS — CID 57448305
2-[4-(piperidin-1-ylmethyl)phenoxy]-[1,3]thiazolo[4,5-c]pyridine (PubChem CID 57448305) has the molecular formula C18H19N3OS and a molecular weight of 325.44 g/mol. Its IUPAC name is 2-[4-(piperidin-1-ylmethyl)phenoxy]-[1,3]thiazolo[4,5-c]pyridine.
| Compound Name | 2-[4-(piperidin-1-ylmethyl)phenoxy]-[1,3]thiazolo[4,5-c]pyridine |
|---|---|
| PubChem CID | 57448305 |
| Molecular Formula | C18H19N3OS |
| Molecular Weight | 325.44 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 2-[4-(piperidin-1-ylmethyl)phenoxy]-[1,3]thiazolo[4,5-c]pyridine |
| SMILES | c1cc2sc(Oc3ccc(CN4CCCCC4)cc3)nc2cn1 |
| InChI | InChI=1S/C18H19N3OS/c1-2-10-21(11-3-1)13-14-4-6-15(7-5-14)22-18-20-16-12-19-9-8-17(16)23-18/h4-9,12H,1-3,10-11,13H2 |
| InChIKey | DNRBWXQTMZJQIJ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.44 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |