About 2-[cyclopropyl-[2-[4-([1,3]thiazolo[5,4-b]pyridin-2-yloxy)phenoxy]ethyl]amino]ethanol
2-[cyclopropyl-[2-[4-([1,3]thiazolo[5,4-b]pyridin-2-yloxy)phenoxy]ethyl]amino]ethanol (PubChem CID 57448325) has the molecular formula C19H21N3O3S
and a molecular weight of 371.46 g/mol. Its IUPAC name is 2-[cyclopropyl-[2-[4-([1,3]thiazolo[5,4-b]pyridin-2-yloxy)phenoxy]ethyl]amino]ethanol.
Molecular Properties
| Compound Name | 2-[cyclopropyl-[2-[4-([1,3]thiazolo[5,4-b]pyridin-2-yloxy)phenoxy]ethyl]amino]ethanol |
| PubChem CID | 57448325 |
| Molecular Formula | C19H21N3O3S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | 2-[cyclopropyl-[2-[4-([1,3]thiazolo[5,4-b]pyridin-2-yloxy)phenoxy]ethyl]amino]ethanol |
| SMILES | OCCN(CCOc1ccc(Oc2nc3cccnc3s2)cc1)C1CC1 |
| InChI | InChI=1S/C19H21N3O3S/c23-12-10-22(14-3-4-14)11-13-24-15-5-7-16(8-6-15)25-19-21-17-2-1-9-20-18(17)26-19/h1-2,5-9,14,23H,3-4,10-13H2 |
| InChIKey | VASSBRDWDMVIDG-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 67.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[cyclopropyl-[2-[4-([1,3]thiazolo[5,4-b]pyridin-2-yloxy)phenoxy]ethyl]amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[cyclopropyl-[2-[4-([1,3]thiazolo[5,4-b]pyridin-2-yloxy)phenoxy]ethyl]amino]ethanol?
The IUPAC name of 2-[cyclopropyl-[2-[4-([1,3]thiazolo[5,4-b]pyridin-2-yloxy)phenoxy]ethyl]amino]ethanol (CID 57448325) is 2-[cyclopropyl-[2-[4-([1,3]thiazolo[5,4-b]pyridin-2-yloxy)phenoxy]ethyl]amino]ethanol.
What is the SMILES notation for 2-[cyclopropyl-[2-[4-([1,3]thiazolo[5,4-b]pyridin-2-yloxy)phenoxy]ethyl]amino]ethanol?
The canonical SMILES for 2-[cyclopropyl-[2-[4-([1,3]thiazolo[5,4-b]pyridin-2-yloxy)phenoxy]ethyl]amino]ethanol is OCCN(CCOc1ccc(Oc2nc3cccnc3s2)cc1)C1CC1.
What is the InChIKey of 2-[cyclopropyl-[2-[4-([1,3]thiazolo[5,4-b]pyridin-2-yloxy)phenoxy]ethyl]amino]ethanol?
The InChIKey is VASSBRDWDMVIDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21N3O3S/c23-12-10-22(14-3-4-14)11-13-24-15-5-7-16(8-6-15)25-19-21-17-2-1-9-20-18(17)26-19/h1-2,5-9,14,23H,3-4,10-13H2.
What are the key properties of 2-[cyclopropyl-[2-[4-([1,3]thiazolo[5,4-b]pyridin-2-yloxy)phenoxy]ethyl]amino]ethanol?
2-[cyclopropyl-[2-[4-([1,3]thiazolo[5,4-b]pyridin-2-yloxy)phenoxy]ethyl]amino]ethanol has a molecular weight of 371.46 g/mol, XLogP of 3.32, 9 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[cyclopropyl-[2-[4-([1,3]thiazolo[5,4-b]pyridin-2-yloxy)phenoxy]ethyl]amino]ethanol is sourced from PubChem (CID 57448325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).