C19H21N3O2S — CID 57448332
2-[4-(2-piperidin-1-ylethoxy)phenoxy]-[1,3]thiazolo[4,5-b]pyridine (PubChem CID 57448332) has the molecular formula C19H21N3O2S and a molecular weight of 355.46 g/mol. Its IUPAC name is 2-[4-(2-piperidin-1-ylethoxy)phenoxy]-[1,3]thiazolo[4,5-b]pyridine.
| Compound Name | 2-[4-(2-piperidin-1-ylethoxy)phenoxy]-[1,3]thiazolo[4,5-b]pyridine |
|---|---|
| PubChem CID | 57448332 |
| Molecular Formula | C19H21N3O2S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 2-[4-(2-piperidin-1-ylethoxy)phenoxy]-[1,3]thiazolo[4,5-b]pyridine |
| SMILES | c1cnc2nc(Oc3ccc(OCCN4CCCCC4)cc3)sc2c1 |
| InChI | InChI=1S/C19H21N3O2S/c1-2-11-22(12-3-1)13-14-23-15-6-8-16(9-7-15)24-19-21-18-17(25-19)5-4-10-20-18/h4-10H,1-3,11-14H2 |
| InChIKey | XTCOURRKNYLYQZ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |