C13H17N2NaO2 — CID 57448397
sodium 4-[(4-carbamoylpiperidin-1-yl)methyl]phenolate (PubChem CID 57448397) has the molecular formula C13H17N2NaO2 and a molecular weight of 256.28 g/mol. Its IUPAC name is sodium 4-[(4-carbamoylpiperidin-1-yl)methyl]phenolate.
| Compound Name | sodium 4-[(4-carbamoylpiperidin-1-yl)methyl]phenolate |
|---|---|
| PubChem CID | 57448397 |
| Molecular Formula | C13H17N2NaO2 |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | sodium 4-[(4-carbamoylpiperidin-1-yl)methyl]phenolate |
| SMILES | NC(=O)C1CCN(Cc2ccc([O-])cc2)CC1.[Na+] |
| InChI | InChI=1S/C13H18N2O2.Na/c14-13(17)11-5-7-15(8-6-11)9-10-1-3-12(16)4-2-10;/h1-4,11,16H,5-9H2,(H2,14,17);/q;+1/p-1 |
| InChIKey | VLBBVUAFCYCSNT-UHFFFAOYSA-M |
| XLogP | -2.54 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | -2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |