About (2Z)-2-(1,4-benzodiazepin-2-ylidene)acetamide
(2Z)-2-(1,4-benzodiazepin-2-ylidene)acetamide (PubChem CID 57449244) has the molecular formula C11H9N3O
and a molecular weight of 199.21 g/mol. Its IUPAC name is (2Z)-2-(1,4-benzodiazepin-2-ylidene)acetamide.
Molecular Properties
| Compound Name | (2Z)-2-(1,4-benzodiazepin-2-ylidene)acetamide |
| PubChem CID | 57449244 |
| Molecular Formula | C11H9N3O |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.07 |
| IUPAC Name | (2Z)-2-(1,4-benzodiazepin-2-ylidene)acetamide |
| SMILES | NC(=O)/C=C1/C=NC=c2ccccc2=N1 |
| InChI | InChI=1S/C11H9N3O/c12-11(15)5-9-7-13-6-8-3-1-2-4-10(8)14-9/h1-7H,(H2,12,15)/b9-5- |
| InChIKey | RFRJZWOCMUTXJR-UITAMQMPSA-N |
| XLogP | -0.50 |
| TPSA | 67.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-2-(1,4-benzodiazepin-2-ylidene)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-(1,4-benzodiazepin-2-ylidene)acetamide?
The IUPAC name of (2Z)-2-(1,4-benzodiazepin-2-ylidene)acetamide (CID 57449244) is (2Z)-2-(1,4-benzodiazepin-2-ylidene)acetamide.
What is the SMILES notation for (2Z)-2-(1,4-benzodiazepin-2-ylidene)acetamide?
The canonical SMILES for (2Z)-2-(1,4-benzodiazepin-2-ylidene)acetamide is NC(=O)/C=C1/C=NC=c2ccccc2=N1.
What is the InChIKey of (2Z)-2-(1,4-benzodiazepin-2-ylidene)acetamide?
The InChIKey is RFRJZWOCMUTXJR-UITAMQMPSA-N. The full InChI is InChI=1S/C11H9N3O/c12-11(15)5-9-7-13-6-8-3-1-2-4-10(8)14-9/h1-7H,(H2,12,15)/b9-5-.
What are the key properties of (2Z)-2-(1,4-benzodiazepin-2-ylidene)acetamide?
(2Z)-2-(1,4-benzodiazepin-2-ylidene)acetamide has a molecular weight of 199.21 g/mol, XLogP of -0.50, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-(1,4-benzodiazepin-2-ylidene)acetamide is sourced from PubChem (CID 57449244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).