C18H24N2O5 — CID 57449423
tert-butyl (3S)-1-(2-amino-2-oxoethyl)-8-methoxy-2-oxo-4,5-dihydro-3H-1-benzazepine-3-carboxylate (PubChem CID 57449423) has the molecular formula C18H24N2O5 and a molecular weight of 348.40 g/mol. Its IUPAC name is tert-butyl (3S)-1-(2-amino-2-oxoethyl)-8-methoxy-2-oxo-4,5-dihydro-3H-1-benzazepine-3-carboxylate.
| Compound Name | tert-butyl (3S)-1-(2-amino-2-oxoethyl)-8-methoxy-2-oxo-4,5-dihydro-3H-1-benzazepine-3-carboxylate |
|---|---|
| PubChem CID | 57449423 |
| Molecular Formula | C18H24N2O5 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | tert-butyl (3S)-1-(2-amino-2-oxoethyl)-8-methoxy-2-oxo-4,5-dihydro-3H-1-benzazepine-3-carboxylate |
| SMILES | COc1ccc2c(c1)N(CC(N)=O)C(=O)[C@@H](C(=O)OC(C)(C)C)CC2 |
| InChI | InChI=1S/C18H24N2O5/c1-18(2,3)25-17(23)13-8-6-11-5-7-12(24-4)9-14(11)20(16(13)22)10-15(19)21/h5,7,9,13H,6,8,10H2,1-4H3,(H2,19,21)/t13-/m0/s1 |
| InChIKey | VKBVEOGCWLTJMH-ZDUSSCGKSA-N |
| XLogP | 1.42 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|