C20H17F6N3O4S — CID 57450052
[[1-amino-3-phenyl-3-(trifluoromethyl)-4H-isoquinolin-6-yl]methyl-methylsulfonylamino] 2,2,2-trifluoroacetate (PubChem CID 57450052) has the molecular formula C20H17F6N3O4S and a molecular weight of 509.43 g/mol. Its IUPAC name is [[1-amino-3-phenyl-3-(trifluoromethyl)-4H-isoquinolin-6-yl]methyl-methylsulfonylamino] 2,2,2-trifluoroacetate.
| Compound Name | [[1-amino-3-phenyl-3-(trifluoromethyl)-4H-isoquinolin-6-yl]methyl-methylsulfonylamino] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 57450052 |
| Molecular Formula | C20H17F6N3O4S |
| Molecular Weight | 509.43 g/mol |
| Exact Mass | 509.08 |
| IUPAC Name | [[1-amino-3-phenyl-3-(trifluoromethyl)-4H-isoquinolin-6-yl]methyl-methylsulfonylamino] 2,2,2-trifluoroacetate |
| SMILES | CS(=O)(=O)N(Cc1ccc2c(c1)CC(c1ccccc1)(C(F)(F)F)N=C2N)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C20H17F6N3O4S/c1-34(31,32)29(33-17(30)19(21,22)23)11-12-7-8-15-13(9-12)10-18(20(24,25)26,28-16(15)27)14-5-3-2-4-6-14/h2-9H,10-11H2,1H3,(H2,27,28) |
| InChIKey | FNOKINVSYRCXIA-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.43 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|