About isoquinolin-1-yl 2,2,2-trifluoroacetate
isoquinolin-1-yl 2,2,2-trifluoroacetate (PubChem CID 57450719) has the molecular formula C11H6F3NO2
and a molecular weight of 241.17 g/mol. Its IUPAC name is isoquinolin-1-yl 2,2,2-trifluoroacetate.
Molecular Properties
| Compound Name | isoquinolin-1-yl 2,2,2-trifluoroacetate |
| PubChem CID | 57450719 |
| Molecular Formula | C11H6F3NO2 |
| Molecular Weight | 241.17 g/mol |
| Exact Mass | 241.04 |
| IUPAC Name | isoquinolin-1-yl 2,2,2-trifluoroacetate |
| SMILES | O=C(Oc1nccc2ccccc12)C(F)(F)F |
| InChI | InChI=1S/C11H6F3NO2/c12-11(13,14)10(16)17-9-8-4-2-1-3-7(8)5-6-15-9/h1-6H |
| InChIKey | FAWWTQZORDWYPB-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.17 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze isoquinolin-1-yl 2,2,2-trifluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of isoquinolin-1-yl 2,2,2-trifluoroacetate?
The IUPAC name of isoquinolin-1-yl 2,2,2-trifluoroacetate (CID 57450719) is isoquinolin-1-yl 2,2,2-trifluoroacetate.
What is the SMILES notation for isoquinolin-1-yl 2,2,2-trifluoroacetate?
The canonical SMILES for isoquinolin-1-yl 2,2,2-trifluoroacetate is O=C(Oc1nccc2ccccc12)C(F)(F)F.
What is the InChIKey of isoquinolin-1-yl 2,2,2-trifluoroacetate?
The InChIKey is FAWWTQZORDWYPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6F3NO2/c12-11(13,14)10(16)17-9-8-4-2-1-3-7(8)5-6-15-9/h1-6H.
What are the key properties of isoquinolin-1-yl 2,2,2-trifluoroacetate?
isoquinolin-1-yl 2,2,2-trifluoroacetate has a molecular weight of 241.17 g/mol, XLogP of 2.70, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for isoquinolin-1-yl 2,2,2-trifluoroacetate is sourced from PubChem (CID 57450719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).