About 1-(1,3-dihydroxypropan-2-yl)pyrimidine-2,4-dione
1-(1,3-dihydroxypropan-2-yl)pyrimidine-2,4-dione (PubChem CID 574509) has the molecular formula C7H10N2O4
and a molecular weight of 186.17 g/mol. Its IUPAC name is 1-(1,3-dihydroxypropan-2-yl)pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 1-(1,3-dihydroxypropan-2-yl)pyrimidine-2,4-dione |
| PubChem CID | 574509 |
| Molecular Formula | C7H10N2O4 |
| Molecular Weight | 186.17 g/mol |
| Exact Mass | 186.06 |
| IUPAC Name | 1-(1,3-dihydroxypropan-2-yl)pyrimidine-2,4-dione |
| SMILES | O=c1ccn(C(CO)CO)c(=O)[nH]1 |
| InChI | InChI=1S/C7H10N2O4/c10-3-5(4-11)9-2-1-6(12)8-7(9)13/h1-2,5,10-11H,3-4H2,(H,8,12,13) |
| InChIKey | ACSDBZFQEPIONY-UHFFFAOYSA-N |
| XLogP | -1.94 |
| TPSA | 95.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.17 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(1,3-dihydroxypropan-2-yl)pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,3-dihydroxypropan-2-yl)pyrimidine-2,4-dione?
The IUPAC name of 1-(1,3-dihydroxypropan-2-yl)pyrimidine-2,4-dione (CID 574509) is 1-(1,3-dihydroxypropan-2-yl)pyrimidine-2,4-dione.
What is the SMILES notation for 1-(1,3-dihydroxypropan-2-yl)pyrimidine-2,4-dione?
The canonical SMILES for 1-(1,3-dihydroxypropan-2-yl)pyrimidine-2,4-dione is O=c1ccn(C(CO)CO)c(=O)[nH]1.
What is the InChIKey of 1-(1,3-dihydroxypropan-2-yl)pyrimidine-2,4-dione?
The InChIKey is ACSDBZFQEPIONY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O4/c10-3-5(4-11)9-2-1-6(12)8-7(9)13/h1-2,5,10-11H,3-4H2,(H,8,12,13).
What are the key properties of 1-(1,3-dihydroxypropan-2-yl)pyrimidine-2,4-dione?
1-(1,3-dihydroxypropan-2-yl)pyrimidine-2,4-dione has a molecular weight of 186.17 g/mol, XLogP of -1.94, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,3-dihydroxypropan-2-yl)pyrimidine-2,4-dione is sourced from PubChem (CID 574509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).