About 5-methyl-1,3,4-thiadiazolidine-2-thione
5-methyl-1,3,4-thiadiazolidine-2-thione (PubChem CID 57451776) has the molecular formula C3H6N2S2
and a molecular weight of 134.23 g/mol. Its IUPAC name is 5-methyl-1,3,4-thiadiazolidine-2-thione.
Molecular Properties
| Compound Name | 5-methyl-1,3,4-thiadiazolidine-2-thione |
| PubChem CID | 57451776 |
| Molecular Formula | C3H6N2S2 |
| Molecular Weight | 134.23 g/mol |
| Exact Mass | 134.00 |
| IUPAC Name | 5-methyl-1,3,4-thiadiazolidine-2-thione |
| SMILES | CC1NNC(=S)S1 |
| InChI | InChI=1S/C3H6N2S2/c1-2-4-5-3(6)7-2/h2,4H,1H3,(H,5,6) |
| InChIKey | FYEVBBRYDGKJTA-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.23 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-1,3,4-thiadiazolidine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-1,3,4-thiadiazolidine-2-thione?
The IUPAC name of 5-methyl-1,3,4-thiadiazolidine-2-thione (CID 57451776) is 5-methyl-1,3,4-thiadiazolidine-2-thione.
What is the SMILES notation for 5-methyl-1,3,4-thiadiazolidine-2-thione?
The canonical SMILES for 5-methyl-1,3,4-thiadiazolidine-2-thione is CC1NNC(=S)S1.
What is the InChIKey of 5-methyl-1,3,4-thiadiazolidine-2-thione?
The InChIKey is FYEVBBRYDGKJTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6N2S2/c1-2-4-5-3(6)7-2/h2,4H,1H3,(H,5,6).
What are the key properties of 5-methyl-1,3,4-thiadiazolidine-2-thione?
5-methyl-1,3,4-thiadiazolidine-2-thione has a molecular weight of 134.23 g/mol, XLogP of 0.46, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-1,3,4-thiadiazolidine-2-thione is sourced from PubChem (CID 57451776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).