About (1-hydroxy-3H-2,1-benzoxaborol-3-yl)methanamine
(1-hydroxy-3H-2,1-benzoxaborol-3-yl)methanamine (PubChem CID 57451828) has the molecular formula C8H10BNO2
and a molecular weight of 162.99 g/mol. Its IUPAC name is (1-hydroxy-3H-2,1-benzoxaborol-3-yl)methanamine.
Molecular Properties
| Compound Name | (1-hydroxy-3H-2,1-benzoxaborol-3-yl)methanamine |
| PubChem CID | 57451828 |
| Molecular Formula | C8H10BNO2 |
| Molecular Weight | 162.99 g/mol |
| Exact Mass | 163.08 |
| IUPAC Name | (1-hydroxy-3H-2,1-benzoxaborol-3-yl)methanamine |
| SMILES | NCC1OB(O)c2ccccc21 |
| InChI | InChI=1S/C8H10BNO2/c10-5-8-6-3-1-2-4-7(6)9(11)12-8/h1-4,8,11H,5,10H2 |
| InChIKey | CIBFETVOAAGXSK-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.99 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (1-hydroxy-3H-2,1-benzoxaborol-3-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-hydroxy-3H-2,1-benzoxaborol-3-yl)methanamine?
The IUPAC name of (1-hydroxy-3H-2,1-benzoxaborol-3-yl)methanamine (CID 57451828) is (1-hydroxy-3H-2,1-benzoxaborol-3-yl)methanamine.
What is the SMILES notation for (1-hydroxy-3H-2,1-benzoxaborol-3-yl)methanamine?
The canonical SMILES for (1-hydroxy-3H-2,1-benzoxaborol-3-yl)methanamine is NCC1OB(O)c2ccccc21.
What is the InChIKey of (1-hydroxy-3H-2,1-benzoxaborol-3-yl)methanamine?
The InChIKey is CIBFETVOAAGXSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10BNO2/c10-5-8-6-3-1-2-4-7(6)9(11)12-8/h1-4,8,11H,5,10H2.
What are the key properties of (1-hydroxy-3H-2,1-benzoxaborol-3-yl)methanamine?
(1-hydroxy-3H-2,1-benzoxaborol-3-yl)methanamine has a molecular weight of 162.99 g/mol, XLogP of -0.60, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-hydroxy-3H-2,1-benzoxaborol-3-yl)methanamine is sourced from PubChem (CID 57451828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).