About 6-chlorohepta-1,2,6-trienyl acetate
6-chlorohepta-1,2,6-trienyl acetate (PubChem CID 57452739) has the molecular formula C9H11ClO2
and a molecular weight of 186.64 g/mol. Its IUPAC name is 6-chlorohepta-1,2,6-trienyl acetate.
Molecular Properties
| Compound Name | 6-chlorohepta-1,2,6-trienyl acetate |
| PubChem CID | 57452739 |
| Molecular Formula | C9H11ClO2 |
| Molecular Weight | 186.64 g/mol |
| Exact Mass | 186.04 |
| IUPAC Name | 6-chlorohepta-1,2,6-trienyl acetate |
| SMILES | C=C(Cl)CCC=C=COC(C)=O |
| InChI | InChI=1S/C9H11ClO2/c1-8(10)6-4-3-5-7-12-9(2)11/h3,7H,1,4,6H2,2H3 |
| InChIKey | BDDUUBYTDWYKCZ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.64 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 6-chlorohepta-1,2,6-trienyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chlorohepta-1,2,6-trienyl acetate?
The IUPAC name of 6-chlorohepta-1,2,6-trienyl acetate (CID 57452739) is 6-chlorohepta-1,2,6-trienyl acetate.
What is the SMILES notation for 6-chlorohepta-1,2,6-trienyl acetate?
The canonical SMILES for 6-chlorohepta-1,2,6-trienyl acetate is C=C(Cl)CCC=C=COC(C)=O.
What is the InChIKey of 6-chlorohepta-1,2,6-trienyl acetate?
The InChIKey is BDDUUBYTDWYKCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11ClO2/c1-8(10)6-4-3-5-7-12-9(2)11/h3,7H,1,4,6H2,2H3.
What are the key properties of 6-chlorohepta-1,2,6-trienyl acetate?
6-chlorohepta-1,2,6-trienyl acetate has a molecular weight of 186.64 g/mol, XLogP of 2.75, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chlorohepta-1,2,6-trienyl acetate is sourced from PubChem (CID 57452739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).