C25H24N4O3S — CID 57453277
benzyl N-[2-[2-(1,2-benzothiazol-3-ylamino)ethylamino]-2-oxo-1-phenylethyl]carbamate (PubChem CID 57453277) has the molecular formula C25H24N4O3S and a molecular weight of 460.56 g/mol. Its IUPAC name is benzyl N-[2-[2-(1,2-benzothiazol-3-ylamino)ethylamino]-2-oxo-1-phenylethyl]carbamate.
| Compound Name | benzyl N-[2-[2-(1,2-benzothiazol-3-ylamino)ethylamino]-2-oxo-1-phenylethyl]carbamate |
|---|---|
| PubChem CID | 57453277 |
| Molecular Formula | C25H24N4O3S |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | benzyl N-[2-[2-(1,2-benzothiazol-3-ylamino)ethylamino]-2-oxo-1-phenylethyl]carbamate |
| SMILES | O=C(NC(C(=O)NCCNc1nsc2ccccc12)c1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C25H24N4O3S/c30-24(27-16-15-26-23-20-13-7-8-14-21(20)33-29-23)22(19-11-5-2-6-12-19)28-25(31)32-17-18-9-3-1-4-10-18/h1-14,22H,15-17H2,(H,26,29)(H,27,30)(H,28,31) |
| InChIKey | PNLBWOJMJWEVNQ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|