C19H16ClN3O2 — CID 57453921
5-[[3-(cyclobutadienyl)-1,2,4,5-tetrahydro-3-benzazepin-7-yl]oxy]pyrazine-2-carbonyl chloride (PubChem CID 57453921) has the molecular formula C19H16ClN3O2 and a molecular weight of 353.81 g/mol. Its IUPAC name is 5-[[3-(cyclobutadienyl)-1,2,4,5-tetrahydro-3-benzazepin-7-yl]oxy]pyrazine-2-carbonyl chloride.
| Compound Name | 5-[[3-(cyclobutadienyl)-1,2,4,5-tetrahydro-3-benzazepin-7-yl]oxy]pyrazine-2-carbonyl chloride |
|---|---|
| PubChem CID | 57453921 |
| Molecular Formula | C19H16ClN3O2 |
| Molecular Weight | 353.81 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 5-[[3-(cyclobutadienyl)-1,2,4,5-tetrahydro-3-benzazepin-7-yl]oxy]pyrazine-2-carbonyl chloride |
| SMILES | O=C(Cl)c1cnc(Oc2ccc3c(c2)CCN(C2=CC=C2)CC3)cn1 |
| InChI | InChI=1S/C19H16ClN3O2/c20-19(24)17-11-22-18(12-21-17)25-16-5-4-13-6-8-23(15-2-1-3-15)9-7-14(13)10-16/h1-5,10-12H,6-9H2 |
| InChIKey | MLLQPOKSQDEBQJ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.81 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|