About 2-(2-chlorocyclohexa-1,3-dien-1-yl)-1,4-dioxine
2-(2-chlorocyclohexa-1,3-dien-1-yl)-1,4-dioxine (PubChem CID 57454154) has the molecular formula C10H9ClO2
and a molecular weight of 196.63 g/mol. Its IUPAC name is 2-(2-chlorocyclohexa-1,3-dien-1-yl)-1,4-dioxine.
Molecular Properties
| Compound Name | 2-(2-chlorocyclohexa-1,3-dien-1-yl)-1,4-dioxine |
| PubChem CID | 57454154 |
| Molecular Formula | C10H9ClO2 |
| Molecular Weight | 196.63 g/mol |
| Exact Mass | 196.03 |
| IUPAC Name | 2-(2-chlorocyclohexa-1,3-dien-1-yl)-1,4-dioxine |
| SMILES | ClC1=C(C2=COC=CO2)CCC=C1 |
| InChI | InChI=1S/C10H9ClO2/c11-9-4-2-1-3-8(9)10-7-12-5-6-13-10/h2,4-7H,1,3H2 |
| InChIKey | POAZSMIFEFXVKN-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.63 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(2-chlorocyclohexa-1,3-dien-1-yl)-1,4-dioxine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-chlorocyclohexa-1,3-dien-1-yl)-1,4-dioxine?
The IUPAC name of 2-(2-chlorocyclohexa-1,3-dien-1-yl)-1,4-dioxine (CID 57454154) is 2-(2-chlorocyclohexa-1,3-dien-1-yl)-1,4-dioxine.
What is the SMILES notation for 2-(2-chlorocyclohexa-1,3-dien-1-yl)-1,4-dioxine?
The canonical SMILES for 2-(2-chlorocyclohexa-1,3-dien-1-yl)-1,4-dioxine is ClC1=C(C2=COC=CO2)CCC=C1.
What is the InChIKey of 2-(2-chlorocyclohexa-1,3-dien-1-yl)-1,4-dioxine?
The InChIKey is POAZSMIFEFXVKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9ClO2/c11-9-4-2-1-3-8(9)10-7-12-5-6-13-10/h2,4-7H,1,3H2.
What are the key properties of 2-(2-chlorocyclohexa-1,3-dien-1-yl)-1,4-dioxine?
2-(2-chlorocyclohexa-1,3-dien-1-yl)-1,4-dioxine has a molecular weight of 196.63 g/mol, XLogP of 3.19, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-chlorocyclohexa-1,3-dien-1-yl)-1,4-dioxine is sourced from PubChem (CID 57454154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).