About 3-(2,3-dimethylcyclopenten-1-yl)butanenitrile
3-(2,3-dimethylcyclopenten-1-yl)butanenitrile (PubChem CID 57454671) has the molecular formula C11H17N
and a molecular weight of 163.26 g/mol. Its IUPAC name is 3-(2,3-dimethylcyclopenten-1-yl)butanenitrile.
Molecular Properties
| Compound Name | 3-(2,3-dimethylcyclopenten-1-yl)butanenitrile |
| PubChem CID | 57454671 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | 3-(2,3-dimethylcyclopenten-1-yl)butanenitrile |
| SMILES | CC1=C(C(C)CC#N)CCC1C |
| InChI | InChI=1S/C11H17N/c1-8-4-5-11(10(8)3)9(2)6-7-12/h8-9H,4-6H2,1-3H3 |
| InChIKey | CODFNRQEQDVJSU-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,3-dimethylcyclopenten-1-yl)butanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,3-dimethylcyclopenten-1-yl)butanenitrile?
The IUPAC name of 3-(2,3-dimethylcyclopenten-1-yl)butanenitrile (CID 57454671) is 3-(2,3-dimethylcyclopenten-1-yl)butanenitrile.
What is the SMILES notation for 3-(2,3-dimethylcyclopenten-1-yl)butanenitrile?
The canonical SMILES for 3-(2,3-dimethylcyclopenten-1-yl)butanenitrile is CC1=C(C(C)CC#N)CCC1C.
What is the InChIKey of 3-(2,3-dimethylcyclopenten-1-yl)butanenitrile?
The InChIKey is CODFNRQEQDVJSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N/c1-8-4-5-11(10(8)3)9(2)6-7-12/h8-9H,4-6H2,1-3H3.
What are the key properties of 3-(2,3-dimethylcyclopenten-1-yl)butanenitrile?
3-(2,3-dimethylcyclopenten-1-yl)butanenitrile has a molecular weight of 163.26 g/mol, XLogP of 3.28, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,3-dimethylcyclopenten-1-yl)butanenitrile is sourced from PubChem (CID 57454671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).