About N-[4-(diacetylamino)-1,2,5-oxadiazol-3-yl]acetamide
N-[4-(diacetylamino)-1,2,5-oxadiazol-3-yl]acetamide (PubChem CID 574549) has the molecular formula C8H10N4O4
and a molecular weight of 226.19 g/mol. Its IUPAC name is N-[4-(diacetylamino)-1,2,5-oxadiazol-3-yl]acetamide.
Molecular Properties
| Compound Name | N-[4-(diacetylamino)-1,2,5-oxadiazol-3-yl]acetamide |
| PubChem CID | 574549 |
| Molecular Formula | C8H10N4O4 |
| Molecular Weight | 226.19 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | N-[4-(diacetylamino)-1,2,5-oxadiazol-3-yl]acetamide |
| SMILES | CC(=O)Nc1nonc1N(C(C)=O)C(C)=O |
| InChI | InChI=1S/C8H10N4O4/c1-4(13)9-7-8(11-16-10-7)12(5(2)14)6(3)15/h1-3H3,(H,9,10,13) |
| InChIKey | AHHUSWOXXJGRIN-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.19 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[4-(diacetylamino)-1,2,5-oxadiazol-3-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(diacetylamino)-1,2,5-oxadiazol-3-yl]acetamide?
The IUPAC name of N-[4-(diacetylamino)-1,2,5-oxadiazol-3-yl]acetamide (CID 574549) is N-[4-(diacetylamino)-1,2,5-oxadiazol-3-yl]acetamide.
What is the SMILES notation for N-[4-(diacetylamino)-1,2,5-oxadiazol-3-yl]acetamide?
The canonical SMILES for N-[4-(diacetylamino)-1,2,5-oxadiazol-3-yl]acetamide is CC(=O)Nc1nonc1N(C(C)=O)C(C)=O.
What is the InChIKey of N-[4-(diacetylamino)-1,2,5-oxadiazol-3-yl]acetamide?
The InChIKey is AHHUSWOXXJGRIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4O4/c1-4(13)9-7-8(11-16-10-7)12(5(2)14)6(3)15/h1-3H3,(H,9,10,13).
What are the key properties of N-[4-(diacetylamino)-1,2,5-oxadiazol-3-yl]acetamide?
N-[4-(diacetylamino)-1,2,5-oxadiazol-3-yl]acetamide has a molecular weight of 226.19 g/mol, XLogP of -0.07, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(diacetylamino)-1,2,5-oxadiazol-3-yl]acetamide is sourced from PubChem (CID 574549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).