C6H2F10 — CID 57455069
(E)-1,1,1,4,5,5,5-heptafluoro-4-(trifluoromethyl)pent-2-ene (PubChem CID 57455069) has the molecular formula C6H2F10 and a molecular weight of 264.06 g/mol. Its IUPAC name is (E)-1,1,1,4,5,5,5-heptafluoro-4-(trifluoromethyl)pent-2-ene.
| Compound Name | (E)-1,1,1,4,5,5,5-heptafluoro-4-(trifluoromethyl)pent-2-ene |
|---|---|
| PubChem CID | 57455069 |
| Molecular Formula | C6H2F10 |
| Molecular Weight | 264.06 g/mol |
| Exact Mass | 264.00 |
| IUPAC Name | (E)-1,1,1,4,5,5,5-heptafluoro-4-(trifluoromethyl)pent-2-ene |
| SMILES | FC(F)(F)/C=C/C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H2F10/c7-3(5(11,12)13,6(14,15)16)1-2-4(8,9)10/h1-2H/b2-1+ |
| InChIKey | OPUDNJOIACEIEI-OWOJBTEDSA-N |
| XLogP | 3.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.06 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|