C6H4F8 — CID 57455082
(Z)-3,4,4,5,5,6,6,6-octafluorohex-2-ene (PubChem CID 57455082) has the molecular formula C6H4F8 and a molecular weight of 228.08 g/mol. Its IUPAC name is (Z)-3,4,4,5,5,6,6,6-octafluorohex-2-ene.
| Compound Name | (Z)-3,4,4,5,5,6,6,6-octafluorohex-2-ene |
|---|---|
| PubChem CID | 57455082 |
| Molecular Formula | C6H4F8 |
| Molecular Weight | 228.08 g/mol |
| Exact Mass | 228.02 |
| IUPAC Name | (Z)-3,4,4,5,5,6,6,6-octafluorohex-2-ene |
| SMILES | C/C=C(\F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H4F8/c1-2-3(7)4(8,9)5(10,11)6(12,13)14/h2H,1H3/b3-2- |
| InChIKey | SCFVSGJMZBDUNL-IHWYPQMZSA-N |
| XLogP | 3.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.08 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|