About 2-(9-bromo-1-oxo-2H-benzo[h]isoquinolin-6-yl)-2,2-difluoroacetonitrile
2-(9-bromo-1-oxo-2H-benzo[h]isoquinolin-6-yl)-2,2-difluoroacetonitrile (PubChem CID 57455536) has the molecular formula C15H7BrF2N2O
and a molecular weight of 349.13 g/mol. Its IUPAC name is 2-(9-bromo-1-oxo-2H-benzo[h]isoquinolin-6-yl)-2,2-difluoroacetonitrile.
Molecular Properties
| Compound Name | 2-(9-bromo-1-oxo-2H-benzo[h]isoquinolin-6-yl)-2,2-difluoroacetonitrile |
| PubChem CID | 57455536 |
| Molecular Formula | C15H7BrF2N2O |
| Molecular Weight | 349.13 g/mol |
| Exact Mass | 347.97 |
| IUPAC Name | 2-(9-bromo-1-oxo-2H-benzo[h]isoquinolin-6-yl)-2,2-difluoroacetonitrile |
| SMILES | N#CC(F)(F)c1cc2cc[nH]c(=O)c2c2cc(Br)ccc12 |
| InChI | InChI=1S/C15H7BrF2N2O/c16-9-1-2-10-11(6-9)13-8(3-4-20-14(13)21)5-12(10)15(17,18)7-19/h1-6H,(H,20,21) |
| InChIKey | RFXHTZHMGAQJMG-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.13 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2-(9-bromo-1-oxo-2H-benzo[h]isoquinolin-6-yl)-2,2-difluoroacetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(9-bromo-1-oxo-2H-benzo[h]isoquinolin-6-yl)-2,2-difluoroacetonitrile?
The IUPAC name of 2-(9-bromo-1-oxo-2H-benzo[h]isoquinolin-6-yl)-2,2-difluoroacetonitrile (CID 57455536) is 2-(9-bromo-1-oxo-2H-benzo[h]isoquinolin-6-yl)-2,2-difluoroacetonitrile.
What is the SMILES notation for 2-(9-bromo-1-oxo-2H-benzo[h]isoquinolin-6-yl)-2,2-difluoroacetonitrile?
The canonical SMILES for 2-(9-bromo-1-oxo-2H-benzo[h]isoquinolin-6-yl)-2,2-difluoroacetonitrile is N#CC(F)(F)c1cc2cc[nH]c(=O)c2c2cc(Br)ccc12.
What is the InChIKey of 2-(9-bromo-1-oxo-2H-benzo[h]isoquinolin-6-yl)-2,2-difluoroacetonitrile?
The InChIKey is RFXHTZHMGAQJMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H7BrF2N2O/c16-9-1-2-10-11(6-9)13-8(3-4-20-14(13)21)5-12(10)15(17,18)7-19/h1-6H,(H,20,21).
What are the key properties of 2-(9-bromo-1-oxo-2H-benzo[h]isoquinolin-6-yl)-2,2-difluoroacetonitrile?
2-(9-bromo-1-oxo-2H-benzo[h]isoquinolin-6-yl)-2,2-difluoroacetonitrile has a molecular weight of 349.13 g/mol, XLogP of 4.06, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(9-bromo-1-oxo-2H-benzo[h]isoquinolin-6-yl)-2,2-difluoroacetonitrile is sourced from PubChem (CID 57455536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).