About (5-benzamido-2-pyridinyl) 4-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]piperazine-1-carboxylate
(5-benzamido-2-pyridinyl) 4-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]piperazine-1-carboxylate (PubChem CID 57455904) has the molecular formula C23H25N5O3S
and a molecular weight of 451.55 g/mol. Its IUPAC name is (5-benzamido-2-pyridinyl) 4-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]piperazine-1-carboxylate.
Molecular Properties
| Compound Name | (5-benzamido-2-pyridinyl) 4-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]piperazine-1-carboxylate |
| PubChem CID | 57455904 |
| Molecular Formula | C23H25N5O3S |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | (5-benzamido-2-pyridinyl) 4-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]piperazine-1-carboxylate |
| SMILES | Cc1nc(CCN2CCN(C(=O)Oc3ccc(NC(=O)c4ccccc4)cn3)CC2)cs1 |
| InChI | InChI=1S/C23H25N5O3S/c1-17-25-20(16-32-17)9-10-27-11-13-28(14-12-27)23(30)31-21-8-7-19(15-24-21)26-22(29)18-5-3-2-4-6-18/h2-8,15-16H,9-14H2,1H3,(H,26,29) |
| InChIKey | WEXGUTLHPMGFGT-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (5-benzamido-2-pyridinyl) 4-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-benzamido-2-pyridinyl) 4-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]piperazine-1-carboxylate?
The IUPAC name of (5-benzamido-2-pyridinyl) 4-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]piperazine-1-carboxylate (CID 57455904) is (5-benzamido-2-pyridinyl) 4-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]piperazine-1-carboxylate.
What is the SMILES notation for (5-benzamido-2-pyridinyl) 4-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]piperazine-1-carboxylate?
The canonical SMILES for (5-benzamido-2-pyridinyl) 4-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]piperazine-1-carboxylate is Cc1nc(CCN2CCN(C(=O)Oc3ccc(NC(=O)c4ccccc4)cn3)CC2)cs1.
What is the InChIKey of (5-benzamido-2-pyridinyl) 4-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]piperazine-1-carboxylate?
The InChIKey is WEXGUTLHPMGFGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25N5O3S/c1-17-25-20(16-32-17)9-10-27-11-13-28(14-12-27)23(30)31-21-8-7-19(15-24-21)26-22(29)18-5-3-2-4-6-18/h2-8,15-16H,9-14H2,1H3,(H,26,29).
What are the key properties of (5-benzamido-2-pyridinyl) 4-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]piperazine-1-carboxylate?
(5-benzamido-2-pyridinyl) 4-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]piperazine-1-carboxylate has a molecular weight of 451.55 g/mol, XLogP of 3.46, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (5-benzamido-2-pyridinyl) 4-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]piperazine-1-carboxylate is sourced from PubChem (CID 57455904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).