About 2-(ethylamino)-4,5-dimethylthiophene-3-carbonitrile
2-(ethylamino)-4,5-dimethylthiophene-3-carbonitrile (PubChem CID 57456916) has the molecular formula C9H12N2S
and a molecular weight of 180.28 g/mol. Its IUPAC name is 2-(ethylamino)-4,5-dimethylthiophene-3-carbonitrile.
Molecular Properties
| Compound Name | 2-(ethylamino)-4,5-dimethylthiophene-3-carbonitrile |
| PubChem CID | 57456916 |
| Molecular Formula | C9H12N2S |
| Molecular Weight | 180.28 g/mol |
| Exact Mass | 180.07 |
| IUPAC Name | 2-(ethylamino)-4,5-dimethylthiophene-3-carbonitrile |
| SMILES | CCNc1sc(C)c(C)c1C#N |
| InChI | InChI=1S/C9H12N2S/c1-4-11-9-8(5-10)6(2)7(3)12-9/h11H,4H2,1-3H3 |
| InChIKey | GXUFHKFGMOUAMA-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.28 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(ethylamino)-4,5-dimethylthiophene-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(ethylamino)-4,5-dimethylthiophene-3-carbonitrile?
The IUPAC name of 2-(ethylamino)-4,5-dimethylthiophene-3-carbonitrile (CID 57456916) is 2-(ethylamino)-4,5-dimethylthiophene-3-carbonitrile.
What is the SMILES notation for 2-(ethylamino)-4,5-dimethylthiophene-3-carbonitrile?
The canonical SMILES for 2-(ethylamino)-4,5-dimethylthiophene-3-carbonitrile is CCNc1sc(C)c(C)c1C#N.
What is the InChIKey of 2-(ethylamino)-4,5-dimethylthiophene-3-carbonitrile?
The InChIKey is GXUFHKFGMOUAMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2S/c1-4-11-9-8(5-10)6(2)7(3)12-9/h11H,4H2,1-3H3.
What are the key properties of 2-(ethylamino)-4,5-dimethylthiophene-3-carbonitrile?
2-(ethylamino)-4,5-dimethylthiophene-3-carbonitrile has a molecular weight of 180.28 g/mol, XLogP of 2.67, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(ethylamino)-4,5-dimethylthiophene-3-carbonitrile is sourced from PubChem (CID 57456916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).