C11H17NO — CID 57457967
(2Z,8aS)-2-propylidene-1,3,5,6,8,8a-hexahydroindolizin-7-one (PubChem CID 57457967) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is (2Z,8aS)-2-propylidene-1,3,5,6,8,8a-hexahydroindolizin-7-one.
| Compound Name | (2Z,8aS)-2-propylidene-1,3,5,6,8,8a-hexahydroindolizin-7-one |
|---|---|
| PubChem CID | 57457967 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | (2Z,8aS)-2-propylidene-1,3,5,6,8,8a-hexahydroindolizin-7-one |
| SMILES | CC/C=C1/C[C@H]2CC(=O)CCN2C1 |
| InChI | InChI=1S/C11H17NO/c1-2-3-9-6-10-7-11(13)4-5-12(10)8-9/h3,10H,2,4-8H2,1H3/b9-3-/t10-/m0/s1 |
| InChIKey | XCPUSAZHUFXQSX-BNFOFFDWSA-N |
| XLogP | 1.76 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|