C20H18ClF3N4O2 — CID 57458250
2-[1-(2-chlorophenyl)-3-(trifluoromethyl)pyrazol-5-yl]oxy-N-[4-(dimethylamino)phenyl]acetamide (PubChem CID 57458250) has the molecular formula C20H18ClF3N4O2 and a molecular weight of 438.84 g/mol. Its IUPAC name is 2-[1-(2-chlorophenyl)-3-(trifluoromethyl)pyrazol-5-yl]oxy-N-[4-(dimethylamino)phenyl]acetamide.
| Compound Name | 2-[1-(2-chlorophenyl)-3-(trifluoromethyl)pyrazol-5-yl]oxy-N-[4-(dimethylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 57458250 |
| Molecular Formula | C20H18ClF3N4O2 |
| Molecular Weight | 438.84 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | 2-[1-(2-chlorophenyl)-3-(trifluoromethyl)pyrazol-5-yl]oxy-N-[4-(dimethylamino)phenyl]acetamide |
| SMILES | CN(C)c1ccc(NC(=O)COc2cc(C(F)(F)F)nn2-c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C20H18ClF3N4O2/c1-27(2)14-9-7-13(8-10-14)25-18(29)12-30-19-11-17(20(22,23)24)26-28(19)16-6-4-3-5-15(16)21/h3-11H,12H2,1-2H3,(H,25,29) |
| InChIKey | CTWVTGZPUOSFSK-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.84 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|