C12N4O3 — CID 57458745
1,3-dioxo-2-benzofuran-4,5,6,7-tetracarbonitrile (PubChem CID 57458745) has the molecular formula C12N4O3 and a molecular weight of 248.16 g/mol. Its IUPAC name is 1,3-dioxo-2-benzofuran-4,5,6,7-tetracarbonitrile.
| Compound Name | 1,3-dioxo-2-benzofuran-4,5,6,7-tetracarbonitrile |
|---|---|
| PubChem CID | 57458745 |
| Molecular Formula | C12N4O3 |
| Molecular Weight | 248.16 g/mol |
| Exact Mass | 248.00 |
| IUPAC Name | 1,3-dioxo-2-benzofuran-4,5,6,7-tetracarbonitrile |
| SMILES | N#Cc1c(C#N)c(C#N)c2c(c1C#N)C(=O)OC2=O |
| InChI | InChI=1S/C12N4O3/c13-1-5-6(2-14)8(4-16)10-9(7(5)3-15)11(17)19-12(10)18 |
| InChIKey | RIWFCNLXWBLBIF-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 138.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.16 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|