About methyl 3-bromo-9H-pyrido[2,3-b]indole-6-carboxylate
methyl 3-bromo-9H-pyrido[2,3-b]indole-6-carboxylate (PubChem CID 57458947) has the molecular formula C13H9BrN2O2
and a molecular weight of 305.13 g/mol. Its IUPAC name is methyl 3-bromo-9H-pyrido[2,3-b]indole-6-carboxylate.
Molecular Properties
| Compound Name | methyl 3-bromo-9H-pyrido[2,3-b]indole-6-carboxylate |
| PubChem CID | 57458947 |
| Molecular Formula | C13H9BrN2O2 |
| Molecular Weight | 305.13 g/mol |
| Exact Mass | 303.98 |
| IUPAC Name | methyl 3-bromo-9H-pyrido[2,3-b]indole-6-carboxylate |
| SMILES | COC(=O)c1ccc2[nH]c3ncc(Br)cc3c2c1 |
| InChI | InChI=1S/C13H9BrN2O2/c1-18-13(17)7-2-3-11-9(4-7)10-5-8(14)6-15-12(10)16-11/h2-6H,1H3,(H,15,16) |
| InChIKey | XSSABRUCLXIQNS-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.13 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 3-bromo-9H-pyrido[2,3-b]indole-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-bromo-9H-pyrido[2,3-b]indole-6-carboxylate?
The IUPAC name of methyl 3-bromo-9H-pyrido[2,3-b]indole-6-carboxylate (CID 57458947) is methyl 3-bromo-9H-pyrido[2,3-b]indole-6-carboxylate.
What is the SMILES notation for methyl 3-bromo-9H-pyrido[2,3-b]indole-6-carboxylate?
The canonical SMILES for methyl 3-bromo-9H-pyrido[2,3-b]indole-6-carboxylate is COC(=O)c1ccc2[nH]c3ncc(Br)cc3c2c1.
What is the InChIKey of methyl 3-bromo-9H-pyrido[2,3-b]indole-6-carboxylate?
The InChIKey is XSSABRUCLXIQNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9BrN2O2/c1-18-13(17)7-2-3-11-9(4-7)10-5-8(14)6-15-12(10)16-11/h2-6H,1H3,(H,15,16).
What are the key properties of methyl 3-bromo-9H-pyrido[2,3-b]indole-6-carboxylate?
methyl 3-bromo-9H-pyrido[2,3-b]indole-6-carboxylate has a molecular weight of 305.13 g/mol, XLogP of 3.27, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-bromo-9H-pyrido[2,3-b]indole-6-carboxylate is sourced from PubChem (CID 57458947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).