C21H19F4N5O — CID 57459482
7-[4-(3-fluoro-2-methoxyphenyl)piperidin-1-yl]-3-(2,2,2-trifluoroethyl)-[1,2,4]triazolo[4,3-a]pyridine-8-carbonitrile (PubChem CID 57459482) has the molecular formula C21H19F4N5O and a molecular weight of 433.41 g/mol. Its IUPAC name is 7-[4-(3-fluoro-2-methoxyphenyl)piperidin-1-yl]-3-(2,2,2-trifluoroethyl)-[1,2,4]triazolo[4,3-a]pyridine-8-carbonitrile.
| Compound Name | 7-[4-(3-fluoro-2-methoxyphenyl)piperidin-1-yl]-3-(2,2,2-trifluoroethyl)-[1,2,4]triazolo[4,3-a]pyridine-8-carbonitrile |
|---|---|
| PubChem CID | 57459482 |
| Molecular Formula | C21H19F4N5O |
| Molecular Weight | 433.41 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | 7-[4-(3-fluoro-2-methoxyphenyl)piperidin-1-yl]-3-(2,2,2-trifluoroethyl)-[1,2,4]triazolo[4,3-a]pyridine-8-carbonitrile |
| SMILES | COc1c(F)cccc1C1CCN(c2ccn3c(CC(F)(F)F)nnc3c2C#N)CC1 |
| InChI | InChI=1S/C21H19F4N5O/c1-31-19-14(3-2-4-16(19)22)13-5-8-29(9-6-13)17-7-10-30-18(11-21(23,24)25)27-28-20(30)15(17)12-26/h2-4,7,10,13H,5-6,8-9,11H2,1H3 |
| InChIKey | KIKMVMBYJOLYAG-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 66.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.41 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |