C16H14ClFN2S — CID 57461258
1-[4-chloro-2-[(4-fluoro-1H-indol-3-yl)sulfanyl]phenyl]-N-methylmethanamine (PubChem CID 57461258) has the molecular formula C16H14ClFN2S and a molecular weight of 320.82 g/mol. Its IUPAC name is 1-[4-chloro-2-[(4-fluoro-1H-indol-3-yl)sulfanyl]phenyl]-N-methylmethanamine.
| Compound Name | 1-[4-chloro-2-[(4-fluoro-1H-indol-3-yl)sulfanyl]phenyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 57461258 |
| Molecular Formula | C16H14ClFN2S |
| Molecular Weight | 320.82 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | 1-[4-chloro-2-[(4-fluoro-1H-indol-3-yl)sulfanyl]phenyl]-N-methylmethanamine |
| SMILES | CNCc1ccc(Cl)cc1Sc1c[nH]c2cccc(F)c12 |
| InChI | InChI=1S/C16H14ClFN2S/c1-19-8-10-5-6-11(17)7-14(10)21-15-9-20-13-4-2-3-12(18)16(13)15/h2-7,9,19-20H,8H2,1H3 |
| InChIKey | ZLOKQZVGEHJUJU-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.82 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |